| Product Name | 2,4-Dihydroxy-3,6-dimethylbenzoic acid |
| CAS No. | 4707-46-4 |
| Synonyms | 3,6-Dimethyl-2,4-dihydroxybenzoic acid |
| InChI | InChI=1/C9H10O4/c1-4-3-6(10)5(2)8(11)7(4)9(12)13/h3,10-11H,1-2H3,(H,12,13) |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.1733 |
| Density | 1.386g/cm3 |
| Boiling point | 407.4°C at 760 mmHg |
| Flash point | 214.3°C |
| Refractive index | 1.627 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4707-46-4 2,4-dihydroxy-3,6-dimethylbenzoic acid
service@apichina.com