| Product Name | ethyl 4-nitro-1H-indole-2-carboxylate |
| CAS No. | 4993-93-5 |
| Synonyms | 1H-indole-2-carboxylic acid, 4-nitro-, ethyl ester; Ethyl 4-nitro-1H-indole-2-carboxylate; Ethyl 4-nitroindole-2-carboxylate |
| InChI | InChI=1/C11H10N2O4/c1-2-17-11(14)9-6-7-8(12-9)4-3-5-10(7)13(15)16/h3-6,12H,2H2,1H3 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.2081 |
| Density | 1.393g/cm3 |
| Boiling point | 429.5°C at 760 mmHg |
| Flash point | 213.5°C |
| Refractive index | 1.652 |
4993-93-5 ethyl 4-nitro-1h-indole-2-carboxylate
service@apichina.com