| Product Name | 1-(6-nitro-1H-indol-3-yl)ethanone |
| CAS No. | 4993-92-4 |
| InChI | InChI=1/C10H8N2O3/c1-6(13)9-5-11-10-4-7(12(14)15)2-3-8(9)10/h2-5,11H,1H3 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.1821 |
| Density | 1.405g/cm3 |
| Boiling point | 429.1°C at 760 mmHg |
| Flash point | 213.3°C |
| Refractive index | 1.683 |
4993-92-4 1-(6-nitro-1h-indol-3-yl)ethanone
service@apichina.com