| Product Name | DL-Anabasine |
| CAS No. | 13078-04-1 |
| Synonyms | 2-Pyridin-3-ylpiperidine; Neonicotine~2-(3-Pyridyl)piperidine; 3-piperidin-2-ylpyridine; 3-(piperidin-2-yl)pyridine hydrochloride (1:1); 3-(2-piperidyl)pyridine; 3-(piperidin-2-yl)pyridine |
| InChI | InChI=1/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.2316 |
| Density | 1.014g/cm3 |
| Melting point | 9℃ |
| Boiling point | 271°C at 760 mmHg |
| Flash point | 93.3°C |
| Refractive index | 1.524 |
| Hazard Symbols | |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; |
| Safety | S28A:After contact with skin, wash immediately with plenty of water.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
13078-04-1 dl-anabasine
service@apichina.com