| Sales Email | Service@apichina.com |
| CAS No. | 13078-12-1 |
| Product Name | 1-(4-Chlorophenyl)-piperazine monohydrochloride |
| Synonyms | 1-(4-Chlorophenyl)piperazine monohydrochloride; 1-(4-chlorophenyl)piperazine hydrochloride |
| InChI | InChI=1/C10H13ClN2.ClH/c11-9-1-3-10(4-2-9)13-7-5-12-6-8-13;/h1-4,12H,5-8H2;1H |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.1376 |
| Boiling point | 336.3°C at 760 mmHg |
| Flash point | 157.2°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
