| Product Name | benzyl 4-brornophenyl ketone |
| CAS No. | 2001-29-8 |
| Synonyms | 4-Bromodeoxybenzoin~4-Bromo-alpha-phenylacetophenone; Benzyl 4-bromophenyl ketone; 1-(4-bromophenyl)-2-phenylethanone; 4'-Bromo-2-Phenylacetophenone |
| InChI | InChI=1/C14H11BrO/c15-13-8-6-12(7-9-13)14(16)10-11-4-2-1-3-5-11/h1-9H,10H2 |
| Molecular Formula | C14H11BrO |
| Molecular Weight | 275.1405 |
| Density | 1.39g/cm3 |
| Melting point | 112-116℃ |
| Boiling point | 383.2°C at 760 mmHg |
| Flash point | 84.6°C |
| Refractive index | 1.608 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
2001-29-8 benzyl 4-brornophenyl ketone
service@apichina.com