| Product Name | 4-hydroxy-1-methyl-2(1H)quinolone |
| CAS No. | 1677-46-9 |
| Synonyms | 4-Hydroxy-1-methyl-2(1H)-quinolone; 4-Hydroxy-1-methyl-2-quinolone; 4-Hydroxy-1-Metyl-2-(1H)Quinolone; 4-Hydroxy-1-methyl-1,2-dihydroquinolin-2-one; 2-hydroxy-1-methylquinolin-4(1H)-one; 4-hydroxy-1-methylquinolin-2(1H)-one |
| InChI | InChI=1/C10H9NO2/c1-11-8-5-3-2-4-7(8)9(12)6-10(11)13/h2-6,12H,1H3 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.184 |
| Density | 1.326g/cm3 |
| Melting point | 269-271℃ |
| Boiling point | 297.555°C at 760 mmHg |
| Flash point | 133.756°C |
| Refractive index | 1.647 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1677-46-9 4-hydroxy-1-methyl-2(1h)quinolone
service@apichina.com