| Product Name | Benzoyl bromide |
| CAS No. | 618-32-6 |
| InChI | InChI=1/C7H5BrO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| Molecular Formula | C7H5BrO |
| Molecular Weight | 185.018 |
| Density | 1.572g/cm3 |
| Melting point | -24℃ |
| Boiling point | 218.5°C at 760 mmHg |
| Flash point | 89.7°C |
| Refractive index | 1.584 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S25:Avoid contact with eyes.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
618-32-6 benzoyl bromide
service@apichina.com