| Product Name | Alpha,Alpha-Dibromotoluene |
| CAS No. | 618-31-5 |
| Synonyms | Benzal bromide; (dibromomethyl)benzene |
| InChI | InChI=1/C7H6Br2/c8-7(9)6-4-2-1-3-5-6/h1-5,7H |
| Molecular Formula | C7H6Br2 |
| Molecular Weight | 249.9305 |
| Density | 1.881g/cm3 |
| Boiling point | 276.6°C at 760 mmHg |
| Flash point | 100.2°C |
| Refractive index | 1.619 |
| Hazard Symbols | |
| Risk Codes | R23/24:Toxic by inhalation and in contact with skin.; R33:Danger of cummulative effects.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
618-31-5 alpha,alpha-dibromotoluene
service@apichina.com