| Product Name | 7-chloro-N,N-diethyl-4-nitro-2,1,3-benzoxadiazol-5-amine |
| CAS No. | 257932-06-2 |
| InChI | InChI=1/C10H11ClN4O3/c1-3-14(4-2)7-5-6(11)8-9(13-18-12-8)10(7)15(16)17/h5H,3-4H2,1-2H3 |
| Molecular Formula | C10H11ClN4O3 |
| Molecular Weight | 270.6723 |
| Density | 1.442g/cm3 |
| Melting point | 132℃ |
| Boiling point | 414°C at 760 mmHg |
| Flash point | 204.2°C |
| Refractive index | 1.64 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
257932-06-2 7-chloro-n,n-diethyl-4-nitro-2,1,3-benzoxadiazol-5-amine
service@apichina.com