| Product Name | 7-chloro-4-nitro-5-piperidino-2,1,3-benzoxadiazole |
| CAS No. | 257932-07-3 |
| Synonyms | 7-chloro-4-nitro-5-piperidin-1-yl-2,1,3-benzoxadiazole |
| InChI | InChI=1/C11H11ClN4O3/c12-7-6-8(15-4-2-1-3-5-15)11(16(17)18)10-9(7)13-19-14-10/h6H,1-5H2 |
| Molecular Formula | C11H11ClN4O3 |
| Molecular Weight | 282.683 |
| Density | 1.496g/cm3 |
| Melting point | 159℃ |
| Boiling point | 455.8°C at 760 mmHg |
| Flash point | 229.5°C |
| Refractive index | 1.649 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
257932-07-3 7-chloro-4-nitro-5-piperidino-2,1,3-benzoxadiazole
service@apichina.com