| Product Name | 6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde |
| CAS No. | 306934-87-2 |
| Synonyms | 6-Fluoro-1,3-benzodioxene-8-carbaldehyde |
| InChI | InChI=1/C9H7FO3/c10-8-1-6(3-11)9-7(2-8)4-12-5-13-9/h1-3H,4-5H2 |
| Molecular Formula | C9H7FO3 |
| Molecular Weight | 182.1485 |
| Density | 1.357g/cm3 |
| Melting point | 116℃ |
| Boiling point | 323.051°C at 760 mmHg |
| Flash point | 144.319°C |
| Refractive index | 1.566 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
306934-87-2 6-fluoro-4h-1,3-benzodioxine-8-carbaldehyde
service@apichina.com