| Product Name | (6-fluoro-4H-1,3-benzodioxin-8-yl)methylamine |
| CAS No. | 306934-88-3 |
| Synonyms | (6-Fluoro-4H-1,3-benzodioxen-8-yl)methylamine; 1-(6-fluoro-4H-1,3-benzodioxin-8-yl)methanamine |
| InChI | InChI=1/C9H10FNO2/c10-8-1-6(3-11)9-7(2-8)4-12-5-13-9/h1-2H,3-5,11H2 |
| Molecular Formula | C9H10FNO2 |
| Molecular Weight | 183.1796 |
| Density | 1.285g/cm3 |
| Melting point | 51℃ |
| Boiling point | 314.2°C at 760 mmHg |
| Flash point | 143.8°C |
| Refractive index | 1.55 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
306934-88-3 (6-fluoro-4h-1,3-benzodioxin-8-yl)methylamine
service@apichina.com