| Product Name | 5-phenyl-2-thienylboronic acid |
| CAS No. | 306934-95-2 |
| Synonyms | (5-Phenyl-2-thienyl)boronic acid; boronic acid, B-(5-phenyl-2-thienyl)-; (5-phenylthiophen-2-yl)boronic acid; 2-phenythiophen-5-ylboronic acid |
| InChI | InChI=1/C10H9BO2S/c12-11(13)10-7-6-9(14-10)8-4-2-1-3-5-8/h1-7,12-13H |
| Molecular Formula | C10H9BO2S |
| Molecular Weight | 204.0533 |
| Density | 1.29g/cm3 |
| Melting point | 146℃ |
| Boiling point | 412.9°C at 760 mmHg |
| Flash point | 203.5°C |
| Refractive index | 1.632 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
306934-95-2 5-phenyl-2-thienylboronic acid
service@apichina.com