| Product Name | 5-(2-thienyl)nicotinic acid |
| CAS No. | 306934-96-3 |
| Synonyms | 5-thiophen-2-ylpyridine-3-carboxylic acid |
| InChI | InChI=1/C10H7NO2S/c12-10(13)8-4-7(5-11-6-8)9-2-1-3-14-9/h1-6H,(H,12,13) |
| Molecular Formula | C10H7NO2S |
| Molecular Weight | 205.2331 |
| Density | 1.368g/cm3 |
| Melting point | 277℃ |
| Boiling point | 423.8°C at 760 mmHg |
| Flash point | 210.1°C |
| Refractive index | 1.643 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
306934-96-3 5-(2-thienyl)nicotinic acid
service@apichina.com