| Product Name | 5-methyl-3-phenyl-4-isoxazolyl isothiocyanate |
| CAS No. | 306934-97-4 |
| Synonyms | 4-isothiocyanato-5-methyl-3-phenylisoxazole |
| InChI | InChI=1/C11H8N2OS/c1-8-10(12-7-15)11(13-14-8)9-5-3-2-4-6-9/h2-6H,1H3 |
| Molecular Formula | C11H8N2OS |
| Molecular Weight | 216.259 |
| Density | 1.22g/cm3 |
| Melting point | 65℃ |
| Boiling point | 397.9°C at 760 mmHg |
| Flash point | 194.4°C |
| Refractive index | 1.63 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
306934-97-4 5-methyl-3-phenyl-4-isoxazolyl isothiocyanate
service@apichina.com