| Product Name | 5-Norbornene-2-methanol |
| CAS No. | 95-12-5 |
| Synonyms | 5-Norbornene-2-methanol,mixture of endo and exo; 2-Hydroxymethyl-5-norbornene; 5-Norborene-2-methanol; 5-norbornene-2-methanol(NMO)mixture of endo and exo; bicyclo[2.2.1]hept-5-en-2-ylmethanol; (1R,2S,4R)-bicyclo[2.2.1]hept-5-en-2-ylmethanol |
| InChI | InChI=1/C8H12O/c9-5-8-4-6-1-2-7(8)3-6/h1-2,6-9H,3-5H2/t6-,7+,8-/m1/s1 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.1803 |
| Density | 1.06g/cm3 |
| Boiling point | 189.2°C at 760 mmHg |
| Flash point | 81.6°C |
| Refractive index | 1.53 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:; |
| Safety | S36/37/39:; S45:; |
95-12-5 5-norbornene-2-methanol
service@apichina.com