| Product Name | 5-Norbornene-2-carbonitrile, mixture of endo and exo |
| CAS No. | 95-11-4 |
| Synonyms | Bicyclo[2.2.1]-5-heptene-2-carbonitrile; bicyclo[2.2.1]hept-5-ene-2-carbonitrile; 5-Norbornene-2-carbonitrile; 5-Cyanobicyclo[2.2.1]hept-2-ene |
| InChI | InChI=1/C8H9N/c9-5-8-4-6-1-2-7(8)3-6/h1-2,6-8H,3-4H2 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.1638 |
| Density | 1.06g/cm3 |
| Melting point | 12-14℃ |
| Boiling point | 205.2°C at 760 mmHg |
| Flash point | 65.6°C |
| Refractive index | 1.531 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:; |
| Safety | S36/37:; |
95-11-4 5-norbornene-2-carbonitrile, mixture of endo and exo
service@apichina.com