| Product Name | 5-Chlorovaleric acid |
| CAS No. | 1119-46-6 |
| Synonyms | 214-279-3; pentanoic acid, 5-chloro-; 5-chloropentanoic acid |
| InChI | InChI=1/C5H9ClO2/c6-4-2-1-3-5(7)8/h1-4H2,(H,7,8) |
| Molecular Formula | C5H9ClO2 |
| Molecular Weight | 136.5768 |
| Density | 1.166g/cm3 |
| Melting point | 18-20℃ |
| Boiling point | 230.9°C at 760 mmHg |
| Flash point | 93.4°C |
| Refractive index | 1.452 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1119-46-6 5-chlorovaleric acid
service@apichina.com