| Product Name | 3-Hepten-2-one |
| CAS No. | 1119-44-4 |
| Synonyms | AI3-22032; Butylideneacetone; FEMA No. 3400; Methyl pentenyl ketone; (3E)-hept-3-en-2-one |
| InChI | InChI=1/C7H12O/c1-3-4-5-6-7(2)8/h5-6H,3-4H2,1-2H3/b6-5+ |
| Molecular Formula | C7H12O |
| Molecular Weight | 112.1696 |
| Density | 0.832g/cm3 |
| Boiling point | 157.8°C at 760 mmHg |
| Flash point | 52.2°C |
| Refractive index | 1.426 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1119-44-4 3-hepten-2-one
service@apichina.com