| Product Name | 5-bromo-4-methoxythiophene-3-carbonyl chloride |
| CAS No. | 162848-22-8 |
| InChI | InChI=1/C6H4BrClO2S/c1-10-4-3(6(8)9)2-11-5(4)7/h2H,1H3 |
| Molecular Formula | C6H4BrClO2S |
| Molecular Weight | 255.5168 |
| Density | 1.756g/cm3 |
| Melting point | 77℃ |
| Boiling point | 311.4°C at 760 mmHg |
| Flash point | 142.1°C |
| Refractive index | 1.592 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
162848-22-8 5-bromo-4-methoxythiophene-3-carbonyl chloride
service@apichina.com