| Product Name | 5-bromo-4-methoxythiophene-3-carboxylic acid |
| CAS No. | 162848-23-9 |
| InChI | InChI=1/C6H5BrO3S/c1-10-4-3(6(8)9)2-11-5(4)7/h2H,1H3,(H,8,9) |
| Molecular Formula | C6H5BrO3S |
| Molecular Weight | 237.0711 |
| Density | 1.801g/cm3 |
| Boiling point | 333.087°C at 760 mmHg |
| Flash point | 155.246°C |
| Refractive index | 1.615 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
162848-23-9 5-bromo-4-methoxythiophene-3-carboxylic acid
service@apichina.com