| Product Name | 5-bromo-2,3,4-trimethylbenzoyl chloride |
| CAS No. | 342405-32-7 |
| InChI | InChI=1/C10H10BrClO/c1-5-6(2)8(10(12)13)4-9(11)7(5)3/h4H,1-3H3 |
| Molecular Formula | C10H10BrClO |
| Molecular Weight | 261.5428 |
| Density | 1.446g/cm3 |
| Melting point | 60.1℃ |
| Boiling point | 332.5°C at 760 mmHg |
| Flash point | 154.9°C |
| Refractive index | 1.562 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
342405-32-7 5-bromo-2,3,4-trimethylbenzoyl chloride
service@apichina.com