| Product Name | [4-(4-methylpiperazino)phenyl]methanol |
| CAS No. | 342405-34-9 |
| Synonyms | [4-(4-methylpiperazin-1-yl)phenyl]methanol; 4-[4-(hydroxymethyl)phenyl]-1-methylpiperazin-1-ium |
| InChI | InChI=1/C12H18N2O/c1-13-6-8-14(9-7-13)12-4-2-11(10-15)3-5-12/h2-5,15H,6-10H2,1H3/p+1 |
| Molecular Formula | C12H19N2O |
| Molecular Weight | 207.2915 |
| Melting point | 118℃ |
| Boiling point | 363.7°C at 760 mmHg |
| Flash point | 189.4°C |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
342405-34-9 [4-(4-methylpiperazino)phenyl]methanol
service@apichina.com