| Product Name | 5-Acetylvaleric acid |
| CAS No. | 3128-07-2 |
| Synonyms | 6-Oxoheptanoic acid; 6-Ketoheptanoic acid~6-Oxoheptanoic acid; 6-oxoheptanoate; 6-Oxoenanthic acid |
| InChI | InChI=1/C7H12O3/c1-6(8)4-2-3-5-7(9)10/h2-5H2,1H3,(H,9,10)/p-1 |
| Molecular Formula | C7H11O3 |
| Molecular Weight | 143.161 |
| Melting point | 34-140℃ |
| Boiling point | 299.3°C at 760 mmHg |
| Flash point | 149.1°C |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
3128-07-2 5-acetylvaleric acid
service@apichina.com