| Product Name | 4-acetylbutyric acid |
| CAS No. | 3128-06-1 |
| Synonyms | 5-oxohexanoic acid; Ketohexanoicacid; 5-Ketohexanoic acid~5-Oxohexanoic acid; 5-Ketohexanoic acid |
| InChI | InChI=1/C6H10O3/c1-5(7)3-2-4-6(8)9/h2-4H2,1H3,(H,8,9) |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.1418 |
| Density | 1.09g/cm3 |
| Melting point | 13-14℃ |
| Boiling point | 275.5°C at 760 mmHg |
| Flash point | 134.6°C |
| Refractive index | 1.439 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3128-06-1 4-acetylbutyric acid
service@apichina.com