| Product Name | 5-Acetamido-2-bromobenzoic acid hydrate |
| CAS No. | 22921-67-1 |
| Synonyms | 5-(acetylamino)-2-bromobenzoic acid; 5-(acetylamino)-2-bromobenzoate |
| InChI | InChI=1/C9H8BrNO3/c1-5(12)11-6-2-3-8(10)7(4-6)9(13)14/h2-4H,1H3,(H,11,12)(H,13,14)/p-1 |
| Molecular Formula | C9H7BrNO3 |
| Molecular Weight | 257.0613 |
| Melting point | 186℃ |
| Boiling point | 466°C at 760 mmHg |
| Flash point | 235.6°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
22921-67-1 5-acetamido-2-bromobenzoic acid hydrate
service@apichina.com