| Product Name | 2-Bromo-5-methoxybenzoic acid |
| CAS No. | 22921-68-2 |
| Synonyms | 6-Bromo-m-anisic acid; 2-bromo-5-methoxybenzoate |
| InChI | InChI=1/C8H7BrO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11)/p-1 |
| Molecular Formula | C8H6BrO3 |
| Molecular Weight | 230.036 |
| Melting point | 158-159℃ |
| Boiling point | 337.8°C at 760 mmHg |
| Flash point | 158.1°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
22921-68-2 2-bromo-5-methoxybenzoic acid
service@apichina.com