| Product Name | 5-(4-Chlorophenyl)-1H-tetrazole |
| CAS No. | 16687-61-9 |
| Synonyms | 5-(4-chlorophenyl)-2H-tetrazole |
| InChI | InChI=1/C7H5ClN4/c8-6-3-1-5(2-4-6)7-9-11-12-10-7/h1-4H,(H,9,10,11,12) |
| Molecular Formula | C7H5ClN4 |
| Molecular Weight | 180.5944 |
| Density | 1.448g/cm3 |
| Boiling point | 356.2°C at 760 mmHg |
| Flash point | 200.4°C |
| Refractive index | 1.631 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
16687-61-9 5-(4-chlorophenyl)-1h-tetrazole
service@apichina.com