| Product Name | 5-(4-Nitrophenyl)-1H-tetrazole |
| CAS No. | 16687-60-8 |
| Synonyms | 5-(4-Nitrophenyl)tetrazole; 5-(4-nitrophenyl)-2H-tetrazole |
| InChI | InChI=1/C7H5N5O2/c13-12(14)6-3-1-5(2-4-6)7-8-10-11-9-7/h1-4H,(H,8,9,10,11) |
| Molecular Formula | C7H5N5O2 |
| Molecular Weight | 191.1469 |
| Density | 1.534g/cm3 |
| Boiling point | 435.3°C at 760 mmHg |
| Flash point | 217.1°C |
| Refractive index | 1.662 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
16687-60-8 5-(4-nitrophenyl)-1h-tetrazole
service@apichina.com