| Product Name | 5-(2-pyridyl)thiophene-2-carboxylic acid |
| CAS No. | 119082-97-2 |
| Synonyms | 5-(pyridin-2-yl)thiophene-2-carboxylic acid |
| InChI | InChI=1/C10H7NO2S/c12-10(13)9-5-4-8(14-9)7-3-1-2-6-11-7/h1-6H,(H,12,13) |
| Molecular Formula | C10H7NO2S |
| Molecular Weight | 205.2331 |
| Density | 1.368g/cm3 |
| Melting point | 232℃ |
| Boiling point | 412°C at 760 mmHg |
| Flash point | 203°C |
| Refractive index | 1.643 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
119082-97-2 5-(2-pyridyl)thiophene-2-carboxylic acid
service@apichina.com