| Product Name | 5-(2-pyridinyl)-2-thiophenecarbonyl chloride |
| CAS No. | 119082-98-3 |
| Synonyms | 5-pyridin-2-ylthiophene-2-carbonyl chloride |
| InChI | InChI=1/C10H6ClNOS/c11-10(13)9-5-4-8(14-9)7-3-1-2-6-12-7/h1-6H |
| Molecular Formula | C10H6ClNOS |
| Molecular Weight | 223.6787 |
| Density | 1.365g/cm3 |
| Melting point | 142℃ |
| Boiling point | 362.1°C at 760 mmHg |
| Flash point | 172.8°C |
| Refractive index | 1.62 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
119082-98-3 5-(2-pyridinyl)-2-thiophenecarbonyl chloride
service@apichina.com