| Product Name | 5-(2-methyl-1,3-thiazol-4-yl)-3-isoxazolecarbonyl chloride |
| CAS No. | 368869-89-0 |
| Synonyms | 5-(2-methyl-1,3-thiazol-4-yl)isoxazole-3-carbonyl chloride |
| InChI | InChI=1/C8H5ClN2O2S/c1-4-10-6(3-14-4)7-2-5(8(9)12)11-13-7/h2-3H,1H3 |
| Molecular Formula | C8H5ClN2O2S |
| Molecular Weight | 228.6555 |
| Density | 1.464g/cm3 |
| Melting point | 170℃ |
| Boiling point | 412.1°C at 760 mmHg |
| Flash point | 203°C |
| Refractive index | 1.591 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
368869-89-0 5-(2-methyl-1,3-thiazol-4-yl)-3-isoxazolecarbonyl chloride
service@apichina.com