Sales Email | Service@apichina.com |
CAS No. | 368869-90-3 |
Product Name | 3-(2-chloro-6-fluorophenyl)-N-(2-chloro-3-pyridinyl)-5-methyl-4-isoxazolecarboxamide |
Synonyms | 4-fluorobenzenesulfonic acid; 3-(2-chloro-6-fluorophenyl)-N-(2-chloropyridin-3-yl)-5-methylisoxazole-4-carboxamide |
InChI | InChI=1/C16H10Cl2FN3O2/c1-8-12(16(23)21-11-6-3-7-20-15(11)18)14(22-24-8)13-9(17)4-2-5-10(13)19/h2-7H,1H3,(H,21,23) |
Molecular Formula | C16H10Cl2FN3O2 |
Molecular Weight | 366.1739 |
Density | 1.481g/cm3 |
Boiling point | 449.8°C at 760 mmHg |
Flash point | 225.8°C |
Refractive index | 1.634 |
Hazard Symbols | |
Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |