| Product Name | 4-Nitrophenoxyacetonitrile |
| CAS No. | 33901-46-1 |
| InChI | InChI=1/C8H6N2O3/c9-5-6-13-8-3-1-7(2-4-8)10(11)12/h1-4H,6H2 |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.1448 |
| Density | 1.317g/cm3 |
| Melting point | 74-76℃ |
| Boiling point | 363.9°C at 760 mmHg |
| Flash point | 173.9°C |
| Refractive index | 1.564 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
33901-46-1 4-nitrophenoxyacetonitrile
service@apichina.com