| Product Name | 4-Methylphenoxyacetonitrile |
| CAS No. | 33901-44-9 |
| InChI | InChI=1/C9H9NO/c1-8-2-4-9(5-3-8)11-7-6-10/h2-5H,7H2,1H3 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.1739 |
| Density | 1.054g/cm3 |
| Boiling point | 262.5°C at 760 mmHg |
| Flash point | 109.8°C |
| Refractive index | 1.517 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
33901-44-9 4-methylphenoxyacetonitrile
service@apichina.com