| Product Name | 4-Methyl-3,4-dihydro-2H-1,4-benzoxazin-7-ylboronic acid |
| CAS No. | 499769-86-7 |
| Synonyms | (4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)boronic acid |
| InChI | InChI=1/C9H12BNO3/c1-11-4-5-14-9-6-7(10(12)13)2-3-8(9)11/h2-3,6,12-13H,4-5H2,1H3 |
| Molecular Formula | C9H12BNO3 |
| Molecular Weight | 193.0075 |
| Density | 1.28g/cm3 |
| Melting point | 151.3℃ |
| Boiling point | 405.8°C at 760 mmHg |
| Flash point | 199.2°C |
| Refractive index | 1.592 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
499769-86-7 4-methyl-3,4-dihydro-2h-1,4-benzoxazin-7-ylboronic acid
service@apichina.com