| Product Name | 2-chloro-6-methylnicotinamide |
| CAS No. | 54957-84-5 |
| Synonyms | 2-chloro-6-methylpyridine-3-carboxamide |
| InChI | InChI=1/C7H7ClN2O/c1-4-2-3-5(7(9)11)6(8)10-4/h2-3H,1H3,(H2,9,11) |
| Molecular Formula | C7H7ClN2O |
| Molecular Weight | 170.5963 |
| Density | 1.316g/cm3 |
| Melting point | 176℃ |
| Boiling point | 285.2°C at 760 mmHg |
| Flash point | 126.3°C |
| Refractive index | 1.577 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
54957-84-5 2-chloro-6-methylnicotinamide
service@apichina.com