| Product Name | 4-Isopropoxycarbonylphenylboronic acid |
| CAS No. | 342002-82-8 |
| Synonyms | {4-[(1-methylethoxy)carbonyl]phenyl}boronic acid |
| InChI | InChI=1/C10H13BO4/c1-7(2)15-10(12)8-3-5-9(6-4-8)11(13)14/h3-7,13-14H,1-2H3 |
| Molecular Formula | C10H13BO4 |
| Molecular Weight | 208.0188 |
| Density | 1.17g/cm3 |
| Melting point | 111℃ |
| Boiling point | 359°C at 760 mmHg |
| Flash point | 170.9°C |
| Refractive index | 1.519 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
342002-82-8 4-isopropoxycarbonylphenylboronic acid
service@apichina.com