| Product Name | 3-Borono-Benzoic acid 1-(1-methylethyl) ester |
| CAS No. | 342002-80-6 |
| Synonyms | 3-Isopropoxycarbonylphenylboronic acid; {3-[(1-methylethoxy)carbonyl]phenyl}boronic acid; 4-(2H-tetrazol-5-yl)benzaldehyde |
| InChI | InChI=1/C8H6N4O/c13-5-6-1-3-7(4-2-6)8-9-11-12-10-8/h1-5H,(H,9,10,11,12) |
| Molecular Formula | C8H6N4O |
| Molecular Weight | 174.1594 |
| Density | 1.4g/cm3 |
| Boiling point | 409°C at 760 mmHg |
| Flash point | 203.2°C |
| Refractive index | 1.667 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
342002-80-6 3-borono-benzoic acid 1-(1-methylethyl) ester
service@apichina.com