| Product Name | 4-bromo-1-methyl-1H-pyrazole-3-carbaldehyde |
| CAS No. | 287917-96-8 |
| InChI | InChI=1/C5H5BrN2O/c1-8-5(3-9)4(6)2-7-8/h2-3H,1H3 |
| Molecular Formula | C5H5BrN2O |
| Molecular Weight | 189.01 |
| Density | 1.73g/cm3 |
| Melting point | 68℃ |
| Boiling point | 275.2°C at 760 mmHg |
| Flash point | 120.2°C |
| Refractive index | 1.621 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
287917-96-8 4-bromo-1-methyl-1h-pyrazole-3-carbaldehyde
service@apichina.com