| Product Name | 4-bromo-1H-pyrazole-5-carbaldehyde |
| CAS No. | 287917-97-9 |
| InChI | InChI=1/C4H3BrN2O/c5-3-1-6-7-4(3)2-8/h1-2H,(H,6,7) |
| Molecular Formula | C4H3BrN2O |
| Molecular Weight | 174.9834 |
| Density | 1.969g/cm3 |
| Melting point | 178℃ |
| Boiling point | 338.3°C at 760 mmHg |
| Flash point | 158.4°C |
| Refractive index | 1.67 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
287917-97-9 4-bromo-1h-pyrazole-5-carbaldehyde
service@apichina.com