| Product Name | 4,6-dichloro-1H-indole-2-carbonyl chloride |
| CAS No. | 306937-25-7 |
| InChI | InChI=1/C9H4Cl3NO/c10-4-1-6(11)5-3-8(9(12)14)13-7(5)2-4/h1-3,13H |
| Molecular Formula | C9H4Cl3NO |
| Molecular Weight | 248.4932 |
| Density | 1.632g/cm3 |
| Melting point | 173℃ |
| Boiling point | 404.9°C at 760 mmHg |
| Flash point | 198.7°C |
| Refractive index | 1.696 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
306937-25-7 4,6-dichloro-1h-indole-2-carbonyl chloride
service@apichina.com