| Product Name | 2-methylidene-1,4-dimorpholinobutane-1,4-dione |
| CAS No. | 306937-26-8 |
| Synonyms | 4-(2-methylidene-4-morpholin-4-yl-4-oxobutanoyl)morpholine |
| InChI | InChI=1/C13H20N2O4/c1-11(13(17)15-4-8-19-9-5-15)10-12(16)14-2-6-18-7-3-14/h1-10H2 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.3089 |
| Density | 1.205g/cm3 |
| Melting point | 114℃ |
| Boiling point | 533.3°C at 760 mmHg |
| Flash point | 276.3°C |
| Refractive index | 1.521 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
306937-26-8 2-methylidene-1,4-dimorpholinobutane-1,4-dione
service@apichina.com