| Product Name | 4-(1H-pyrazol-1-yl)phenyl isothiocyanate |
| CAS No. | 352018-96-3 |
| Synonyms | 1-(4-isothiocyanatophenyl)-1H-pyrazole |
| InChI | InChI=1/C10H7N3S/c14-8-11-9-2-4-10(5-3-9)13-7-1-6-12-13/h1-7H |
| Molecular Formula | C10H7N3S |
| Molecular Weight | 201.2477 |
| Density | 1.21g/cm3 |
| Melting point | 97℃ |
| Boiling point | 342°C at 760 mmHg |
| Flash point | 160.6°C |
| Refractive index | 1.657 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
352018-96-3 4-(1h-pyrazol-1-yl)phenyl isothiocyanate
service@apichina.com