| Product Name | 2-(1,4-diazepan-1-yl)nicotinonitrile |
| CAS No. | 352018-97-4 |
| Synonyms | 2-(1,4-diazepan-1-yl)pyridine-3-carbonitrile |
| InChI | InChI=1/C11H14N4/c12-9-10-3-1-5-14-11(10)15-7-2-4-13-6-8-15/h1,3,5,13H,2,4,6-8H2 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.2557 |
| Density | 1.18g/cm3 |
| Boiling point | 394°C at 760 mmHg |
| Flash point | 192.1°C |
| Refractive index | 1.592 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
352018-97-4 2-(1,4-diazepan-1-yl)nicotinonitrile
service@apichina.com