| Product Name | 3-Isopropylbenzeneboronic acid ethylene glycol cyclic ester |
| CAS No. | 374537-96-9 |
| Synonyms | 3-Cumylboronic acid ethylene glycol cyclic ester~[2-(3-Isopropyl)phenyl]-1,3,2-dioxaborolane; 2-[3-(1-methylethyl)phenyl]-1,3,2-dioxaborolane |
| InChI | InChI=1/C11H15BO2/c1-9(2)10-4-3-5-11(8-10)12-13-6-7-14-12/h3-5,8-9H,6-7H2,1-2H3 |
| Molecular Formula | C11H15BO2 |
| Molecular Weight | 190.0466 |
| Density | 1g/cm3 |
| Boiling point | 299.7°C at 760 mmHg |
| Flash point | 135°C |
| Refractive index | 1.493 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
374537-96-9 3-isopropylbenzeneboronic acid ethylene glycol cyclic ester
service@apichina.com