| Product Name | 2-Amino-5-bromo-3,4-dimethylpyridine |
| CAS No. | 374537-97-0 |
| Synonyms | 5-Bromo-3,4-dimethyl-2-pyridinamine; 5-bromo-3,4-dimethylpyridin-2-amine |
| InChI | InChI=1/C7H9BrN2/c1-4-5(2)7(9)10-3-6(4)8/h3H,1-2H3,(H2,9,10) |
| Molecular Formula | C7H9BrN2 |
| Molecular Weight | 201.0638 |
| Density | 1.504g/cm3 |
| Boiling point | 278.2°C at 760 mmHg |
| Flash point | 122°C |
| Refractive index | 1.603 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
374537-97-0 2-amino-5-bromo-3,4-dimethylpyridine
service@apichina.com