| Product Name | 3-hydroxybutyric acid, sodium salt |
| CAS No. | 150-83-4 |
| Synonyms | 3-Hydroxybutyric acid sodium salt; DL-beta-Hydroxybutyric acid sodium salt; Sodium 3-hydroxybutyrate; sodium 3-hydroxybutanoate; butanoic acid, 3-hydroxy-, sodium salt (1:1); Dl-3-Hydroxybutyric Acid Sodium Salt |
| InChI | InChI=1/C4H8O3.Na/c1-3(5)2-4(6)7;/h3,5H,2H2,1H3,(H,6,7); |
| Molecular Formula | C4H8NaO3 |
| Molecular Weight | 127.0943 |
| Melting point | 165-167℃ |
| Boiling point | 269.2°C at 760 mmHg |
| Flash point | 121°C |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
150-83-4 3-hydroxybutyric acid, sodium salt
service@apichina.com