| Product Name | Phytol |
| CAS No. | 7541-49-3 |
| Synonyms | 2-hexadecen-1-ol, 3,7,11,15-tetramethyl-; 3,7,11,15-Tetramethylhexadec-2-en-1-ol |
| InChI | InChI=1/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3 |
| Molecular Formula | C20H40O |
| Molecular Weight | 296.531 |
| Density | 0.845g/cm3 |
| Boiling point | 335.5°C at 760 mmHg |
| Flash point | 157.5°C |
| Refractive index | 1.459 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
7541-49-3 phytol
service@apichina.com